ChemNet > CAS > 499771-09-4 metyl 3-amino-4-cyano-5-piperidinotiofen-2-karboksylat
499771-09-4 metyl 3-amino-4-cyano-5-piperidinotiofen-2-karboksylat
produktnavn |
metyl 3-amino-4-cyano-5-piperidinotiofen-2-karboksylat |
Synonymer |
metyl-3-amino-4-cyano-5-piperidin-1-yltiofen-2-karboksylat |
Engelsk navn |
methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate;methyl 3-amino-4-cyano-5-piperidin-1-ylthiophene-2-carboxylate |
Molekylær Formel |
C12H15N3O2S |
Molekylvekt |
265.3314 |
InChI |
InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3 |
CAS-nummer |
499771-09-4 |
Molecular Structure |
|
Tetthet |
1.33g/cm3 |
Smeltepunkt |
183℃ |
Kokepunkt |
506.1°C at 760 mmHg |
Brytningsindeks |
1.613 |
Flammepunktet |
259.9°C |
Damptrykk |
2.29E-10mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|