502-50-1 4-Ketopimelic acid
produktnavn |
4-Ketopimelic acid |
Engelsk navn |
4-Ketopimelic acid; 4-Oxopimelic acid; 4-oxoheptanedioic acid; 4-oxoheptanedioate |
Molekylær Formel |
C7H8O5 |
Molekylvekt |
172.1365 |
InChI |
InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
CAS-nummer |
502-50-1 |
EINECS |
207-941-8 |
Molecular Structure |
|
Smeltepunkt |
142-144℃ |
Kokepunkt |
420.4°C at 760 mmHg |
Flammepunktet |
222.2°C |
Damptrykk |
3.03E-08mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|