50998-17-9 6-bromoquinoxaline
produktnavn |
6-bromoquinoxaline |
Engelsk navn |
6-bromoquinoxaline; Quinoxaline, 6-bromo- |
Molekylær Formel |
C8H5BrN2 |
Molekylvekt |
209.0427 |
InChI |
InChI=1/C8H5BrN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H |
CAS-nummer |
50998-17-9 |
Molecular Structure |
|
Tetthet |
1.656g/cm3 |
Smeltepunkt |
53℃ |
Kokepunkt |
300.2°C at 760 mmHg |
Brytningsindeks |
1.685 |
Flammepunktet |
135.4°C |
Damptrykk |
0.00203mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|