| produktnavn |
4-(4-klorfenyl)-1,2,3,6-tetrahydropyridinhydroklorid |
| Synonymer |
; 4-(4-klorfenyl)-1,2,3,6-tetrahydro-pyridin HCl; 4-(4-klorfenyl)1,2,3-tetrahydropyridin HCL; 4-(4-klorfenyl)-1,2,3,6-tetrahydropyridinium |
| Engelsk navn |
4-(4-Chlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride; 4-(4-Chlorophenyl)-1,2,3,6-tetrahydro-pyridine HCl; 4-(4-Chloro Phenyl)1,2,3-Tetra Hydropyridine HCL; 4-(4-chlorophenyl)-1,2,3,6-tetrahydropyridinium |
| Molekylær Formel |
C11H13ClN |
| Molekylvekt |
194.6801 |
| InChI |
InChI=1/C11H12ClN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2/p+1 |
| CAS-nummer |
51304-61-1 |
| EINECS |
257-126-6 |
| Molecular Structure |
|
| Smeltepunkt |
199-204℃ |
| Kokepunkt |
296.5°C at 760 mmHg |
| Flammepunktet |
133.1°C |
| Damptrykk |
0.00143mmHg at 25°C |
| Hazard symboler |
T:Toxic;
|
| Risiko Koder |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Sikkerhet Beskrivelse |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|