ChemNet > CAS > 5211-62-1 2-Methoxyphenylacetone
5211-62-1 2-Methoxyphenylacetone
| produktnavn |
2-Methoxyphenylacetone |
| Engelsk navn |
2-Methoxyphenylacetone; 2-Methoxybenzyl methyl ketone; 1-(2-Methoxyphenyl)-2-propanone; 1-(2-methoxyphenyl)propan-2-one |
| Molekylær Formel |
C10H12O2 |
| Molekylvekt |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
| CAS-nummer |
5211-62-1 |
| EINECS |
226-008-6 |
| Molecular Structure |
|
| Tetthet |
1.027g/cm3 |
| Smeltepunkt |
127-130℃ (10 mmHg) |
| Kokepunkt |
261.7°C at 760 mmHg |
| Brytningsindeks |
1.501 |
| Flammepunktet |
94°C |
| Damptrykk |
0.0114mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
