ChemNet > CAS > 524-95-8 Diphenylborinic acid 2-aminoethyl ester
524-95-8 Diphenylborinic acid 2-aminoethyl ester
produktnavn |
Diphenylborinic acid 2-aminoethyl ester |
Engelsk navn |
Diphenylborinic acid 2-aminoethyl ester; 2-Aminoethyl diphenylborinate; diphenylborinic acid; Diphenylboric acid 2-aminoethyl ester; B-(2-Aminoethoxy)diphenylborane; 2-APB; Diphenylboric acid ethanolamine complex |
Molekylær Formel |
C14H16BNO |
Molekylvekt |
225.0939 |
InChI |
InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
CAS-nummer |
524-95-8 |
EINECS |
208-366-5 |
Molecular Structure |
|
Tetthet |
1.04g/cm3 |
Smeltepunkt |
190-194℃ |
Kokepunkt |
325.3°C at 760 mmHg |
Brytningsindeks |
1.559 |
Flammepunktet |
150.6°C |
Damptrykk |
0.000232mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|