ChemNet > CAS > 5290-62-0 4-(4-Nitrophenylazo)-1-naphthol
5290-62-0 4-(4-Nitrophenylazo)-1-naphthol
produktnavn |
4-(4-Nitrophenylazo)-1-naphthol |
Engelsk navn |
4-(4-Nitrophenylazo)-1-naphthol; Magneson II; 4-(4-Nitrophenylalzo)-1-naphthol; 4-[(4-nitrophenyl)hydrazono]naphthalen-1(4H)-one; (4E)-4-[(4-nitrophenyl)hydrazono]naphthalen-1(4H)-one |
Molekylær Formel |
C16H11N3O3 |
Molekylvekt |
293.2768 |
InChI |
InChI=1/C16H11N3O3/c20-16-10-9-15(13-3-1-2-4-14(13)16)18-17-11-5-7-12(8-6-11)19(21)22/h1-10,17H/b18-15+ |
CAS-nummer |
5290-62-0 |
EINECS |
226-129-4 |
Molecular Structure |
|
Tetthet |
1.35g/cm3 |
Smeltepunkt |
270℃ |
Kokepunkt |
483.4°C at 760 mmHg |
Brytningsindeks |
1.673 |
Flammepunktet |
246.2°C |
Damptrykk |
1.68E-09mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|