ChemNet > CAS > 53001-74-4 2,3,4,5-Tetrafluorfenylacetonitril
53001-74-4 2,3,4,5-Tetrafluorfenylacetonitril
produktnavn |
2,3,4,5-Tetrafluorfenylacetonitril |
Synonymer |
; 2,3,4,5-Tetrafluorbenzylcyanid |
Engelsk navn |
2,3,4,5-Tetrafluorophenylacetonitrile; 2,3,4,5-Tetrafluorobenzyl cyanide |
Molekylær Formel |
C8H3F4N |
Molekylvekt |
189.1097 |
InChI |
InChI=1/C8H3F4N/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3H,1H2 |
CAS-nummer |
53001-74-4 |
Molecular Structure |
|
Tetthet |
1.427g/cm3 |
Kokepunkt |
208.5°C at 760 mmHg |
Brytningsindeks |
1.451 |
Flammepunktet |
103.9°C |
Damptrykk |
0.213mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|