ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
produktnavn |
3-Ethoxy-2-cyclohexen-1-one |
Engelsk navn |
3-Ethoxy-2-cyclohexen-1-one; 3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
Molekylær Formel |
C8H12O2 |
Molekylvekt |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
CAS-nummer |
5323-87-5 |
EINECS |
226-190-7 |
Molecular Structure |
|
Tetthet |
1g/cm3 |
Kokepunkt |
250.1°C at 760 mmHg |
Brytningsindeks |
1.467 |
Flammepunktet |
107.2°C |
Damptrykk |
0.022mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|