ChemNet > CAS > 5381-20-4 thianaphthene-3-carboxaldehyde
5381-20-4 thianaphthene-3-carboxaldehyde
produktnavn |
thianaphthene-3-carboxaldehyde |
Engelsk navn |
thianaphthene-3-carboxaldehyde; 1-Benzothiophene-3-carbaldehyde; Benzo[b]thiophene-3-carboxaldehyde |
Molekylær Formel |
C9H6OS |
Molekylvekt |
162.2083 |
InChI |
InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
CAS-nummer |
5381-20-4 |
Molecular Structure |
|
Tetthet |
1.3g/cm3 |
Smeltepunkt |
56-58℃ |
Kokepunkt |
303.2°C at 760 mmHg |
Brytningsindeks |
1.719 |
Flammepunktet |
137.2°C |
Damptrykk |
0.000944mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|