ChemNet > CAS > 65651-80-1;53927-12-1 Ethyl trans-3-(1-pyrrolidino)acrylate
65651-80-1;53927-12-1 Ethyl trans-3-(1-pyrrolidino)acrylate
| produktnavn |
Ethyl trans-3-(1-pyrrolidino)acrylate |
| Engelsk navn |
Ethyl trans-3-(1-pyrrolidino)acrylate; Ethyl trans-3-(1-pyrrolidino)propenoate; Ethyl3-(1-pyrrolidinyl)acrylate; ethyl (2E)-3-(pyrrolidin-1-yl)prop-2-enoate |
| Molekylær Formel |
C9H15NO2 |
| Molekylvekt |
169.2209 |
| InChI |
InChI=1/C9H15NO2/c1-2-12-9(11)5-8-10-6-3-4-7-10/h5,8H,2-4,6-7H2,1H3/b8-5+ |
| CAS-nummer |
65651-80-1;53927-12-1 |
| Molecular Structure |
|
| Tetthet |
1.112g/cm3 |
| Kokepunkt |
245.9°C at 760 mmHg |
| Brytningsindeks |
1.554 |
| Flammepunktet |
95.9°C |
| Damptrykk |
0.028mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
