ChemNet > CAS > 5413-05-8 Ethyl 2-phenylacetoacetate
5413-05-8 Ethyl 2-phenylacetoacetate
produktnavn |
Ethyl 2-phenylacetoacetate |
Engelsk navn |
Ethyl 2-phenylacetoacetate; 2-Phenylacetoacetic acid ethyl ester; ethyl 3-oxo-2-phenylbutanoate; ethyl (2S)-3-oxo-2-phenylbutanoate |
Molekylær Formel |
C12H14O3 |
Molekylvekt |
206.2378 |
InChI |
InChI=1/C12H14O3/c1-3-15-12(14)11(9(2)13)10-7-5-4-6-8-10/h4-8,11H,3H2,1-2H3/t11-/m1/s1 |
CAS-nummer |
5413-05-8 |
EINECS |
226-500-0 |
Molecular Structure |
|
Tetthet |
1.087g/cm3 |
Kokepunkt |
281.6°C at 760 mmHg |
Brytningsindeks |
1.503 |
Flammepunktet |
119.2°C |
Damptrykk |
0.00354mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|