ChemNet > CAS > 5422-88-8 Cyclopentyl phenyl ketone
5422-88-8 Cyclopentyl phenyl ketone
produktnavn |
Cyclopentyl phenyl ketone |
Engelsk navn |
Cyclopentyl phenyl ketone; Benzoylcyclopentane; cyclopentyl(phenyl)methanone |
Molekylær Formel |
C12H14O |
Molekylvekt |
174.239 |
InChI |
InChI=1/C12H14O/c13-12(11-8-4-5-9-11)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2 |
CAS-nummer |
5422-88-8 |
EINECS |
226-548-2 |
Molecular Structure |
|
Tetthet |
1.051g/cm3 |
Kokepunkt |
273.9°C at 760 mmHg |
Brytningsindeks |
1.548 |
Flammepunktet |
112.4°C |
Damptrykk |
0.00556mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|