5447-99-4 3-Nitro-2-pentanol
produktnavn |
3-Nitro-2-pentanol |
Engelsk navn |
3-Nitro-2-pentanol; 3-Nitro-2-pentanol,mixture of (?-threo and (?-erythro; 3-nitropentan-2-ol; (2R,3S)-3-nitropentan-2-ol; (2R,3R)-3-nitropentan-2-ol; (2S,3S)-3-nitropentan-2-ol; (2S,3R)-3-nitropentan-2-ol |
Molekylær Formel |
C5H11NO3 |
Molekylvekt |
133.1457 |
InChI |
InChI=1/C5H11NO3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3/t4-,5+/m0/s1 |
CAS-nummer |
5447-99-4 |
EINECS |
226-669-0 |
Molecular Structure |
|
Tetthet |
1.09g/cm3 |
Kokepunkt |
215.8°C at 760 mmHg |
Brytningsindeks |
1.447 |
Flammepunktet |
90.6°C |
Damptrykk |
0.0314mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|