ChemNet > CAS > 5524-05-0 (+)-Dihydrocarvone
5524-05-0 (+)-Dihydrocarvone
| produktnavn |
(+)-Dihydrocarvone |
| Engelsk navn |
(+)-Dihydrocarvone; (+)-Dihydrocarvone, mixture of isomers; p-Menth-8(9)-en-2-one; 8-p-Menthen-2-one; (2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone; (2S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
| Molekylær Formel |
C10H16O |
| Molekylvekt |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
| CAS-nummer |
5524-05-0 |
| EINECS |
226-872-4 |
| Molecular Structure |
|
| Tetthet |
0.903g/cm3 |
| Kokepunkt |
221.5°C at 760 mmHg |
| Brytningsindeks |
1.457 |
| Flammepunktet |
82.6°C |
| Damptrykk |
0.107mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
