ChemNet > CAS > 5541-89-9 4-(1H-indol-3-yl)butan-2-one
5541-89-9 4-(1H-indol-3-yl)butan-2-one
produktnavn |
4-(1H-indol-3-yl)butan-2-one |
Engelsk navn |
4-(1H-indol-3-yl)butan-2-one; |
Molekylær Formel |
C12H13NO |
Molekylvekt |
187.2377 |
InChI |
InChI=1/C12H13NO/c1-9(14)6-7-10-8-13-12-5-3-2-4-11(10)12/h2-5,8,13H,6-7H2,1H3 |
CAS-nummer |
5541-89-9 |
Molecular Structure |
|
Tetthet |
1.136g/cm3 |
Smeltepunkt |
85℃ |
Kokepunkt |
356.1°C at 760 mmHg |
Brytningsindeks |
1.613 |
Flammepunktet |
177°C |
Damptrykk |
2.98E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|