ChemNet > CAS > 55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
55776-17-5 2,6-Dimethoxy-3-nitrobenzoic acid
produktnavn |
2,6-Dimethoxy-3-nitrobenzoic acid |
Engelsk navn |
2,6-Dimethoxy-3-nitrobenzoic acid; |
Molekylær Formel |
C9H9NO6 |
Molekylvekt |
227.1709 |
InChI |
InChI=1/C9H9NO6/c1-15-6-4-3-5(10(13)14)8(16-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12) |
CAS-nummer |
55776-17-5 |
EINECS |
259-814-1 |
Molecular Structure |
|
Tetthet |
1.403g/cm3 |
Kokepunkt |
420.7°C at 760 mmHg |
Brytningsindeks |
1.569 |
Flammepunktet |
208.2°C |
Damptrykk |
7.92E-08mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|