The physical and chemical property of 568-63-8 is provided by ChemNet.com
Chemical CAS Database with Global Chemical Suppliers - ChemNet


   ChemNet > CAS > 568-63-8 Erythrosine B

568-63-8 Erythrosine B

produktnavn Erythrosine B
Engelsk navn Erythrosine B; Erythrosin B
Molekylær Formel C20H6I4Na2O5
Molekylvekt 879.86
InChI InChI=1/C20H8I4O5.2Na/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2
CAS-nummer 568-63-8
EINECS 240-474-8
Molecular Structure 568-63-8 Erythrosine B
Hazard symboler  Xn:Harmful;
Risiko Koder R22:;
Sikkerhet Beskrivelse S36:;