ChemNet > CAS > 571-61-9 1,5-Dimethylnaphthalene
571-61-9 1,5-Dimethylnaphthalene
| produktnavn |
1,5-Dimethylnaphthalene |
| Engelsk navn |
1,5-Dimethylnaphthalene;NSC 59388; Naphthalene, 1,5-dimethyl-; Naphthalene, 1,5-dimethyl- (8CI)(9CI); N-methyl-N-nitrosomethanamine |
| Molekylær Formel |
C12H12 |
| Molekylvekt |
156.2237 |
| InChI |
InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
| CAS-nummer |
571-61-9 |
| EINECS |
209-338-5 |
| Molecular Structure |
|
| Tetthet |
1g/cm3 |
| Smeltepunkt |
78-266℃ |
| Kokepunkt |
265.6°C at 760 mmHg |
| Brytningsindeks |
1.604 |
| Flammepunktet |
111.4°C |
| Damptrykk |
0.0149mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
