ChemNet > CAS > 5721-12-0 etyl 2,6-diaminoheksanoatdihydroklorid
5721-12-0 etyl 2,6-diaminoheksanoatdihydroklorid
produktnavn |
etyl 2,6-diaminoheksanoatdihydroklorid |
Synonymer |
Etyl DL-lysinat dihydroklorid; Etyl DL-lysinat HCl |
Engelsk navn |
ethyl 2,6-diaminohexanoate dihydrochloride;Ethyl DL-lysinate dihydrochloride; Ethyl DL-lysinate HCl |
Molekylær Formel |
C8H20Cl2N2O2 |
Molekylvekt |
247.16
|
InChI |
InChI=1/C8H18N2O2.2ClH/c1-2-12-8(11)7(10)5-3-4-6-9;;/h7H,2-6,9-10H2,1H3;2*1H |
CAS-nummer |
5721-12-0 |
EINECS |
227-224-3 |
Molecular Structure |
|
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|