ChemNet > CAS > 57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
57319-65-0 6-amino-1,3-dihydroisobenzofuran-1-one
produktnavn |
6-amino-1,3-dihydroisobenzofuran-1-one |
Engelsk navn |
6-amino-1,3-dihydroisobenzofuran-1-one; 6-Aminophtalide; 6-amino-2-benzofuran-1(3H)-one |
Molekylær Formel |
C8H7NO2 |
Molekylvekt |
149.1467 |
InChI |
InChI=1/C8H7NO2/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3H,4,9H2 |
CAS-nummer |
57319-65-0 |
EINECS |
260-675-4 |
Molecular Structure |
|
Tetthet |
1.376g/cm3 |
Smeltepunkt |
182℃ |
Kokepunkt |
420.2°C at 760 mmHg |
Brytningsindeks |
1.655 |
Flammepunktet |
248.3°C |
Damptrykk |
2.87E-07mmHg at 25°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|