ChemNet > CAS > 579-39-5 4,4'-Difluorobenzil
579-39-5 4,4'-Difluorobenzil
| produktnavn |
4,4'-Difluorobenzil |
| Engelsk navn |
4,4'-Difluorobenzil; 4,4-Difluorodibenzoyl; 4,4-Fluorobenzil; 1,2-bis(4-fluorophenyl)ethane-1,2-dione |
| Molekylær Formel |
C14H8F2O2 |
| Molekylvekt |
246.2089 |
| InChI |
InChI=1/C14H8F2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H |
| CAS-nummer |
579-39-5 |
| Molecular Structure |
|
| Tetthet |
1.304g/cm3 |
| Smeltepunkt |
119-122℃ |
| Kokepunkt |
370.2°C at 760 mmHg |
| Brytningsindeks |
1.562 |
| Flammepunktet |
141.5°C |
| Damptrykk |
1.13E-05mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
