ChemNet > CAS > 589-06-0 4-(4-Fluorophenyl)butyric acid
589-06-0 4-(4-Fluorophenyl)butyric acid
produktnavn |
4-(4-Fluorophenyl)butyric acid |
Engelsk navn |
4-(4-Fluorophenyl)butyric acid;4-(p-Fluorophenyl)butyric acid; 4-(4-fluorophenyl)butanoate |
Molekylær Formel |
C10H10FO2 |
Molekylvekt |
181.1842 |
InChI |
InChI=1/C10H11FO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3H2,(H,12,13)/p-1 |
CAS-nummer |
589-06-0 |
EINECS |
209-631-8 |
Molecular Structure |
|
Smeltepunkt |
38℃ |
Kokepunkt |
296.5°C at 760 mmHg |
Flammepunktet |
133.1°C |
Damptrykk |
0.000646mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|