591-08-2 N-Acetylthiourea
produktnavn |
N-Acetylthiourea |
Engelsk navn |
N-Acetylthiourea; N-Acetylthiourea,98%; N-carbamothioylacetamide |
Molekylær Formel |
C3H6N2OS |
Molekylvekt |
118.1575 |
InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
CAS-nummer |
591-08-2 |
EINECS |
209-699-9 |
Molecular Structure |
|
Tetthet |
1.275g/cm3 |
Smeltepunkt |
166-168℃ |
Kokepunkt |
208.6°C at 760 mmHg |
Brytningsindeks |
1.569 |
Flammepunktet |
80°C |
Damptrykk |
0.212mmHg at 25°C |
Hazard symboler |
T:Toxic;
|
Risiko Koder |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|