ChemNet > CAS > 5916-12-1 2-Acetylthiophene ethylene acetal
5916-12-1 2-Acetylthiophene ethylene acetal
produktnavn |
2-Acetylthiophene ethylene acetal |
Engelsk navn |
2-Acetylthiophene ethylene acetal; 2-Methyl-2-(2-thienyl)-1,3-dioxolane; 2-methyl-2-thiophen-2-yl-1,3-dioxolane |
Molekylær Formel |
C8H10O2S |
Molekylvekt |
170.2288 |
InChI |
InChI=1/C8H10O2S/c1-8(9-4-5-10-8)7-3-2-6-11-7/h2-3,6H,4-5H2,1H3 |
CAS-nummer |
5916-12-1 |
Molecular Structure |
|
Tetthet |
1.191g/cm3 |
Kokepunkt |
243.7°C at 760 mmHg |
Brytningsindeks |
1.535 |
Flammepunktet |
101.2°C |
Damptrykk |
0.0495mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|