ChemNet > CAS > 59463-56-8 cyanometyletioat
59463-56-8 cyanometyletioat
| produktnavn |
cyanometyletioat |
| Synonymer |
S-(cyanometyl) etetioat |
| Engelsk navn |
cyanomethyl ethanethioate;S-(cyanomethyl) ethanethioate |
| Molekylær Formel |
C4H5NOS |
| Molekylvekt |
115.1536 |
| InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
| CAS-nummer |
59463-56-8 |
| Molecular Structure |
|
| Tetthet |
1.162g/cm3 |
| Kokepunkt |
198.1°C at 760 mmHg |
| Brytningsindeks |
1.487 |
| Flammepunktet |
73.6°C |
| Damptrykk |
0.367mmHg at 25°C |
| Hazard symboler |
 Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|
