59463-56-8 cyanometyletioat
produktnavn |
cyanometyletioat |
Synonymer |
S-(cyanometyl) etetioat |
Engelsk navn |
cyanomethyl ethanethioate;S-(cyanomethyl) ethanethioate |
Molekylær Formel |
C4H5NOS |
Molekylvekt |
115.1536 |
InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
CAS-nummer |
59463-56-8 |
Molecular Structure |
|
Tetthet |
1.162g/cm3 |
Kokepunkt |
198.1°C at 760 mmHg |
Brytningsindeks |
1.487 |
Flammepunktet |
73.6°C |
Damptrykk |
0.367mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|