596-09-8 Fluorescein diacetate
produktnavn |
Fluorescein diacetate |
Engelsk navn |
Fluorescein diacetate; Diacetylfluorescein; Fluorescein Diacetat; 3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diyl diacetate |
Molekylær Formel |
C24H16O7 |
Molekylvekt |
416.3796 |
InChI |
InChI=1/C24H16O7/c1-13(25)28-15-7-9-19-21(11-15)30-22-12-16(29-14(2)26)8-10-20(22)24(19)18-6-4-3-5-17(18)23(27)31-24/h3-12H,1-2H3 |
CAS-nummer |
596-09-8 |
EINECS |
209-877-6 |
Molecular Structure |
|
Tetthet |
1.47g/cm3 |
Smeltepunkt |
206-208℃ |
Kokepunkt |
604.7°C at 760 mmHg |
Brytningsindeks |
1.681 |
Flammepunktet |
264°C |
Damptrykk |
1.42E-14mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|