603-52-1 ethyl diphenylcarbamate
produktnavn |
ethyl diphenylcarbamate |
Engelsk navn |
ethyl diphenylcarbamate; |
Molekylær Formel |
C15H15NO2 |
Molekylvekt |
241.2851 |
InChI |
InChI=1/C15H15NO2/c1-2-18-15(17)16(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
CAS-nummer |
603-52-1 |
EINECS |
210-047-0 |
Molecular Structure |
|
Tetthet |
1.146g/cm3 |
Smeltepunkt |
70-72℃ |
Kokepunkt |
360°C at 760 mmHg |
Brytningsindeks |
1.593 |
Flammepunktet |
171.5°C |
Damptrykk |
2.29E-05mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|