60388-53-6 DL-ametopterinhydrat
produktnavn |
DL-ametopterinhydrat |
Synonymer |
;D L-4-amino-N10-metylpteroylglutaminsyre; (pluss-minus)-ametopterin |
Engelsk navn |
DL-Amethopterin hydrate; DL-4-Amino-N10-methylpteroylglutamic acid; (plus-minus)-amethopterin |
Molekylær Formel |
C20H22N8O5 |
Molekylvekt |
454.445 |
InChI |
InChI=1/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27) |
CAS-nummer |
60388-53-6 |
EINECS |
262-213-7 |
Molecular Structure |
|
Smeltepunkt |
195℃ |
Hazard symboler |
T:Toxic;
|
Risiko Koder |
R46:May cause heritable genetic damages.;
R61:May cause harm to the unborn child.;
|
Sikkerhet Beskrivelse |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|