606-43-9 N-Methylcarbostyril
produktnavn |
N-Methylcarbostyril |
Engelsk navn |
N-Methylcarbostyril; 2-Hydroxy-1-methylquinoline; N-Methylcarbostyril; 1-methylquinolin-2(1H)-one; 1-methyl-2-Quinolinone |
Molekylær Formel |
C10H9NO |
Molekylvekt |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-11-9-5-3-2-4-8(9)6-7-10(11)12/h2-7H,1H3 |
CAS-nummer |
606-43-9 |
Molecular Structure |
|
Tetthet |
1.16g/cm3 |
Kokepunkt |
247.5°C at 760 mmHg |
Brytningsindeks |
1.592 |
Flammepunktet |
106.8°C |
Damptrykk |
0.0255mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|