ChemNet > CAS > 611-79-0 3,3'-Diaminobenzophenone
611-79-0 3,3'-Diaminobenzophenone
| produktnavn |
3,3'-Diaminobenzophenone |
| Engelsk navn |
3,3'-Diaminobenzophenone; bis(3-aminophenyl)methanone |
| Molekylær Formel |
C13H12N2O |
| Molekylvekt |
212.2472 |
| InChI |
InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
| CAS-nummer |
611-79-0 |
| EINECS |
210-281-3 |
| Molecular Structure |
|
| Tetthet |
1.233g/cm3 |
| Kokepunkt |
469.4°C at 760 mmHg |
| Brytningsindeks |
1.673 |
| Flammepunktet |
237.7°C |
| Damptrykk |
5.51E-09mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
