613-13-8 2-Aminoanthracene
produktnavn |
2-Aminoanthracene |
Engelsk navn |
2-Aminoanthracene; 2-anthramine practical grade*crystalline; 2-anthrylamine; 2-Anthramine; 2-Anthranamine; anthracen-2-amine; 2-Anthracenamide;
|
Molekylær Formel |
C14H11N |
Molekylvekt |
193.2438 |
InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
CAS-nummer |
613-13-8 |
EINECS |
210-330-9 |
Molecular Structure |
|
Tetthet |
1.208g/cm3 |
Smeltepunkt |
238-241℃ |
Kokepunkt |
414.2°C at 760 mmHg |
Brytningsindeks |
1.765 |
Flammepunktet |
229°C |
Damptrykk |
4.52E-07mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R33:Danger of cummulative effects.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|