ChemNet > CAS > 61471-45-2 3-(1H-pyrrol-1-yl)benzoic acid
61471-45-2 3-(1H-pyrrol-1-yl)benzoic acid
| produktnavn |
3-(1H-pyrrol-1-yl)benzoic acid |
| Engelsk navn |
3-(1H-pyrrol-1-yl)benzoic acid;3-(1H-pyrrol-1-yl)benzoate |
| Molekylær Formel |
C11H8NO2 |
| Molekylvekt |
186.1873 |
| InChI |
InChI=1/C11H9NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,(H,13,14)/p-1 |
| CAS-nummer |
61471-45-2 |
| Molecular Structure |
|
| Smeltepunkt |
268℃ |
| Kokepunkt |
376.6°C at 760 mmHg |
| Flammepunktet |
181.6°C |
| Damptrykk |
2.43E-06mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
