ChemNet > CAS > 618-32-6 Benzoyl bromide
618-32-6 Benzoyl bromide
| produktnavn |
Benzoyl bromide |
| Engelsk navn |
Benzoyl bromide; |
| Molekylær Formel |
C7H5BrO |
| Molekylvekt |
185.018 |
| InChI |
InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| CAS-nummer |
618-32-6 |
| EINECS |
210-544-2 |
| Molecular Structure |
|
| Tetthet |
1.572g/cm3 |
| Smeltepunkt |
-24℃ |
| Kokepunkt |
218.5°C at 760 mmHg |
| Brytningsindeks |
1.584 |
| Flammepunktet |
89.7°C |
| Damptrykk |
0.125mmHg at 25°C |
| Hazard symboler |
 C:Corrosive;
|
| Risiko Koder |
R34:Causes burns.;
|
| Sikkerhet Beskrivelse |
S25:Avoid contact with eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
