ChemNet > CAS > 62096-63-3 2-Amino-4-methylamino-6-ethoxy-1,3,5-triazine
62096-63-3 2-Amino-4-methylamino-6-ethoxy-1,3,5-triazine
| produktnavn |
2-Amino-4-methylamino-6-ethoxy-1,3,5-triazine |
| Engelsk navn |
2-Amino-4-methylamino-6-ethoxy-1,3,5-triazine; |
| Molekylær Formel |
C6H11N5O |
| Molekylvekt |
169.1844 |
| InChI |
InChI=1/C6H11N5O/c1-3-12-6-10-4(7)9-5(8-2)11-6/h3H2,1-2H3,(H3,7,8,9,10,11) |
| CAS-nummer |
62096-63-3 |
| Molecular Structure |
|
| Tetthet |
1.288g/cm3 |
| Smeltepunkt |
171-174℃ |
| Kokepunkt |
365.9°C at 760 mmHg |
| Brytningsindeks |
1.612 |
| Flammepunktet |
175.1°C |
| Damptrykk |
1.52E-05mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
