6214-44-4 4-Ethoxybenzyl alcohol
produktnavn |
4-Ethoxybenzyl alcohol |
Engelsk navn |
4-Ethoxybenzyl alcohol; AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
Molekylær Formel |
C9H12O2 |
Molekylvekt |
152.1904 |
InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
CAS-nummer |
6214-44-4 |
EINECS |
228-283-8 |
Molecular Structure |
|
Tetthet |
1.058g/cm3 |
Smeltepunkt |
27-32℃ |
Kokepunkt |
273°C at 760 mmHg |
Brytningsindeks |
1.524 |
Flammepunktet |
114.4°C |
Damptrykk |
0.00287mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|