ChemNet > CAS > 622-51-5 p-Tolylurea
622-51-5 p-Tolylurea
| produktnavn |
p-Tolylurea |
| Engelsk navn |
p-Tolylurea; 4-Methylphenylurea; 1-(4-methylphenyl)urea |
| Molekylær Formel |
C8H10N2O |
| Molekylvekt |
150.1778 |
| InChI |
InChI=1/C8H10N2O/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| CAS-nummer |
622-51-5 |
| EINECS |
210-739-2 |
| Molecular Structure |
|
| Tetthet |
1.192g/cm3 |
| Smeltepunkt |
180-182℃ |
| Kokepunkt |
255.1°C at 760 mmHg |
| Brytningsindeks |
1.62 |
| Flammepunktet |
108.1°C |
| Damptrykk |
0.0166mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|
