ChemNet > CAS > 623-76-7 1,3-diethylurea
623-76-7 1,3-diethylurea
produktnavn |
1,3-diethylurea |
Engelsk navn |
1,3-diethylurea; N,N-Diethylurea; Diethylurea symmetrical; N,N'-Diethylurea |
Molekylær Formel |
C5H12N2O |
Molekylvekt |
116.1616 |
InChI |
InChI=1/C5H12N2O/c1-3-6-5(8)7-4-2/h3-4H2,1-2H3,(H2,6,7,8) |
CAS-nummer |
623-76-7 |
EINECS |
210-811-3 |
Molecular Structure |
|
Tetthet |
0.923g/cm3 |
Smeltepunkt |
112-113℃ |
Kokepunkt |
263°C at 760 mmHg |
Brytningsindeks |
1.428 |
Flammepunktet |
121.1°C |
Damptrykk |
0.0106mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|