ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
| produktnavn |
2-Nitroethanol |
| Engelsk navn |
2-Nitroethanol;1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
| Molekylær Formel |
C2H5NO3 |
| Molekylvekt |
91.07 |
| InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| CAS-nummer |
625-48-9 |
| EINECS |
210-895-1 |
| Molecular Structure |
|
| Tetthet |
1.267g/cm3 |
| Kokepunkt |
193.8°C at 760 mmHg |
| Brytningsindeks |
1.438 |
| Flammepunktet |
113.8°C |
| Damptrykk |
0.12mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
