ChemNet > CAS > 625-50-3 N-ethylacetamide
625-50-3 N-ethylacetamide
produktnavn |
N-ethylacetamide |
Engelsk navn |
N-ethylacetamide; Ethylacetamide |
Molekylær Formel |
C4H9NO |
Molekylvekt |
87.1204 |
InChI |
InChI=1/C4H9NO/c1-3-5-4(2)6/h3H2,1-2H3,(H,5,6) |
CAS-nummer |
625-50-3 |
EINECS |
210-896-7 |
Molecular Structure |
|
Tetthet |
0.866g/cm3 |
Kokepunkt |
205°C at 760 mmHg |
Brytningsindeks |
1.397 |
Flammepunktet |
105.4°C |
Damptrykk |
0.256mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|