ChemNet > CAS > 62637-91-6 Tetrabromophenolphthalein ethyl ester, potassium salt
62637-91-6 Tetrabromophenolphthalein ethyl ester, potassium salt
produktnavn |
Tetrabromophenolphthalein ethyl ester, potassium salt |
Engelsk navn |
Tetrabromophenolphthalein ethyl ester, potassium salt; Tetrabromophenolphthalein ethyl ester potassium salt; TBPE (=Tetrabromophenolphthalein ethyl ester potassium salt) |
Molekylær Formel |
C22H13Br4KO4.H2O |
Molekylvekt |
718.07
|
InChI |
InChI=1/C22H14Br4O4.K/c1-2-30-22(29)14-6-4-3-5-13(14)19(11-7-15(23)20(27)16(24)8-11)12-9-17(25)21(28)18(26)10-12;/h3-10,27H,2H2,1H3;/q;+1/p-1 |
CAS-nummer |
62637-91-6 |
EINECS |
263-661-6 |
Molecular Structure |
|
Smeltepunkt |
270-276℃ |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|