6267-24-9 Tris(ethylthio)methane
produktnavn |
Tris(ethylthio)methane |
Engelsk navn |
Tris(ethylthio)methane; Ethyl orthothioformate~Triethyl trithioorthoformate; {[bis(ethylsulfanyl)methyl]sulfanyl}ethane |
Molekylær Formel |
C7H16S3 |
Molekylvekt |
196.3969 |
InChI |
InChI=1/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
CAS-nummer |
6267-24-9 |
EINECS |
228-439-5 |
Molecular Structure |
|
Tetthet |
1.053g/cm3 |
Kokepunkt |
269.2°C at 760 mmHg |
Brytningsindeks |
1.539 |
Flammepunktet |
111.3°C |
Damptrykk |
0.0122mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|