6282-00-4 NN-Dipropylformamide
produktnavn |
NN-Dipropylformamide |
Engelsk navn |
NN-Dipropylformamide; N,N-Di-n-propylformamide; N,N-dipropylformamide |
Molekylær Formel |
C7H15NO |
Molekylvekt |
129.2001 |
InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
CAS-nummer |
6282-00-4 |
Molecular Structure |
|
Tetthet |
0.869g/cm3 |
Kokepunkt |
221.3°C at 760 mmHg |
Brytningsindeks |
1.429 |
Flammepunktet |
83.7°C |
Damptrykk |
0.108mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|