6304-16-1 (4-Pyridyl)acetone
produktnavn |
(4-Pyridyl)acetone |
Engelsk navn |
(4-Pyridyl)acetone; 1-(4-Pyridyl)-2-propanone; 1-(pyridin-4-yl)propan-2-one; 1-(4-Pyridyl)-2-acetone; 1-(4-Pyridyl)acetone; 4-Pyridyl acetone |
Molekylær Formel |
C8H9NO |
Molekylvekt |
135.1632 |
InChI |
InChI=1/C8H9NO/c1-7(10)6-8-2-4-9-5-3-8/h2-5H,6H2,1H3 |
CAS-nummer |
6304-16-1 |
EINECS |
228-605-7 |
Molecular Structure |
|
Tetthet |
1.047g/cm3 |
Kokepunkt |
232.523°C at 760 mmHg |
Brytningsindeks |
1.509 |
Flammepunktet |
100.06°C |
Damptrykk |
0.059mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|