ChemNet > CAS > 6320-15-6 6-Chloro-2,4-dimethixypyrimidine
6320-15-6 6-Chloro-2,4-dimethixypyrimidine
| produktnavn |
6-Chloro-2,4-dimethixypyrimidine |
| Engelsk navn |
6-Chloro-2,4-dimethixypyrimidine; 6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
| Molekylær Formel |
C6H7ClN2O2 |
| Molekylvekt |
174.585 |
| InChI |
InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
| CAS-nummer |
6320-15-6 |
| EINECS |
228-669-6 |
| Molecular Structure |
|
| Tetthet |
1.285g/cm3 |
| Smeltepunkt |
74-76℃ |
| Kokepunkt |
280.6°C at 760 mmHg |
| Brytningsindeks |
1.51 |
| Flammepunktet |
123.5°C |
| Damptrykk |
0.00637mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
