ChemNet > CAS > 63435-16-5 Methyl 4-amino-3-hydroxybenzoate
63435-16-5 Methyl 4-amino-3-hydroxybenzoate
| produktnavn |
Methyl 4-amino-3-hydroxybenzoate |
| Engelsk navn |
Methyl 4-amino-3-hydroxybenzoate; 4-Amino-3-hydroxybenzoic acid methyl ester |
| Molekylær Formel |
C8H9NO3 |
| Molekylvekt |
167.162 |
| InChI |
InChI=1/C8H9NO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,9H2,1H3 |
| CAS-nummer |
63435-16-5 |
| Molecular Structure |
|
| Tetthet |
1.305g/cm3 |
| Kokepunkt |
364.5°C at 760 mmHg |
| Brytningsindeks |
1.605 |
| Flammepunktet |
174.2°C |
| Damptrykk |
7.99E-06mmHg at 25°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
