6410-10-2 Para Red
produktnavn |
Para Red |
Engelsk navn |
Para Red; C.I. 12070; C.I. Pigment Red 1; C.I. Pigment Red 1 (8CI); 2-Naphthalenol, 1-(2-(4-nitrophenyl)diazenyl)-; 1-(4-Nitrophenylazo)-2-naphthol; 1-[(4-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1Z)-1-[(4-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1E)-1-[(4-nitrophenyl)hydrazono]naphthalen-2(1H)-one |
Molekylær Formel |
C16H11N3O3 |
Molekylvekt |
293.2768 |
InChI |
InChI=1/C16H11N3O3/c20-15-10-5-11-3-1-2-4-14(11)16(15)18-17-12-6-8-13(9-7-12)19(21)22/h1-10,17H/b18-16+ |
CAS-nummer |
6410-10-2 |
EINECS |
229-093-8 |
Molecular Structure |
|
Tetthet |
1.35g/cm3 |
Smeltepunkt |
248-252℃ |
Kokepunkt |
489.5°C at 760 mmHg |
Brytningsindeks |
1.673 |
Flammepunktet |
249.8°C |
Damptrykk |
9.94E-10mmHg at 25°C |
Hazard symboler |
|
Risiko Koder |
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|