ChemNet > CAS > 6484-25-9 4-klor-2-fenylkinazolin
6484-25-9 4-klor-2-fenylkinazolin
| produktnavn |
4-klor-2-fenylkinazolin |
| Synonymer |
; AM-ex-OL |
| Engelsk navn |
4-Chloro-2-phenylquinazoline; AM-ex-OL |
| Molekylær Formel |
C14H9ClN2 |
| Molekylvekt |
240.6877 |
| InChI |
InChI=1/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H |
| CAS-nummer |
6484-25-9 |
| EINECS |
229-346-2 |
| Molecular Structure |
|
| Tetthet |
1.285g/cm3 |
| Smeltepunkt |
123-128℃ |
| Kokepunkt |
301.2°C at 760 mmHg |
| Brytningsindeks |
1.667 |
| Flammepunktet |
164.4°C |
| Damptrykk |
0.00191mmHg at 25°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
