ChemNet > CAS > 6575-09-3 2-Chloro-6-methylbenzonitrile
6575-09-3 2-Chloro-6-methylbenzonitrile
produktnavn |
2-Chloro-6-methylbenzonitrile |
Engelsk navn |
2-Chloro-6-methylbenzonitrile; 6-Chloro-o-tolunitrile; 3-chloro-2-toluonitrile |
Molekylær Formel |
C8H6ClN |
Molekylvekt |
151.5929 |
InChI |
InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
CAS-nummer |
6575-09-3 |
EINECS |
229-499-5 |
Molecular Structure |
|
Tetthet |
1.19g/cm3 |
Smeltepunkt |
78-83℃ |
Kokepunkt |
241.1°C at 760 mmHg |
Brytningsindeks |
1.553 |
Flammepunktet |
110.1°C |
Damptrykk |
0.0367mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|